C20H34O4 — CID 58825214
(2R)-4-[(2R,3S,3aR,3bR,6aS,7aS)-7a-hydroxy-3,3b,4,6,6a-pentamethyl-3,3a,4,5,6,7-hexahydro-2H-pentaleno[2,1-b]furan-2-yl]-2-methylbutanoic acid (PubChem CID 58825214) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is (2R)-4-[(2R,3S,3aR,3bR,6aS,7aS)-7a-hydroxy-3,3b,4,6,6a-pentamethyl-3,3a,4,5,6,7-hexahydro-2H-pentaleno[2,1-b]furan-2-yl]-2-methylbutanoic acid.
| Compound Name | (2R)-4-[(2R,3S,3aR,3bR,6aS,7aS)-7a-hydroxy-3,3b,4,6,6a-pentamethyl-3,3a,4,5,6,7-hexahydro-2H-pentaleno[2,1-b]furan-2-yl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 58825214 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (2R)-4-[(2R,3S,3aR,3bR,6aS,7aS)-7a-hydroxy-3,3b,4,6,6a-pentamethyl-3,3a,4,5,6,7-hexahydro-2H-pentaleno[2,1-b]furan-2-yl]-2-methylbutanoic acid |
| SMILES | CC1CC(C)[C@]2(C)[C@H]3[C@H](C)[C@@H](CC[C@@H](C)C(=O)O)O[C@@]3(O)C[C@@]12C |
| InChI | InChI=1S/C20H34O4/c1-11(17(21)22)7-8-15-14(4)16-19(6)13(3)9-12(2)18(19,5)10-20(16,23)24-15/h11-16,23H,7-10H2,1-6H3,(H,21,22)/t11-,12?,13?,14-,15-,16-,18+,19-,20+/m1/s1 |
| InChIKey | DFJKRJVMSBJJKE-KEZCCNQJSA-N |
| XLogP | 3.92 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |