C22H22N8 — CID 58825422
1-[[2,4,5-tris(imidazol-1-ylmethyl)phenyl]methyl]imidazole (PubChem CID 58825422) has the molecular formula C22H22N8 and a molecular weight of 398.47 g/mol. Its IUPAC name is 1-[[2,4,5-tris(imidazol-1-ylmethyl)phenyl]methyl]imidazole.
| Compound Name | 1-[[2,4,5-tris(imidazol-1-ylmethyl)phenyl]methyl]imidazole |
|---|---|
| PubChem CID | 58825422 |
| Molecular Formula | C22H22N8 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1-[[2,4,5-tris(imidazol-1-ylmethyl)phenyl]methyl]imidazole |
| SMILES | c1cn(Cc2cc(Cn3ccnc3)c(Cn3ccnc3)cc2Cn2ccnc2)cn1 |
| InChI | InChI=1S/C22H22N8/c1-5-27(15-23-1)11-19-9-21(13-29-7-3-25-17-29)22(14-30-8-4-26-18-30)10-20(19)12-28-6-2-24-16-28/h1-10,15-18H,11-14H2 |
| InChIKey | YSFJZLVJLAOPGF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 71.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |