C13H11F15O2 — CID 58825812
8-(2-ethenoxyethoxy)-1,1,1,2,3,3,4,4,5,5,6,6-dodecafluoro-2-(trifluoromethyl)octane (PubChem CID 58825812) has the molecular formula C13H11F15O2 and a molecular weight of 484.20 g/mol. Its IUPAC name is 8-(2-ethenoxyethoxy)-1,1,1,2,3,3,4,4,5,5,6,6-dodecafluoro-2-(trifluoromethyl)octane.
| Compound Name | 8-(2-ethenoxyethoxy)-1,1,1,2,3,3,4,4,5,5,6,6-dodecafluoro-2-(trifluoromethyl)octane |
|---|---|
| PubChem CID | 58825812 |
| Molecular Formula | C13H11F15O2 |
| Molecular Weight | 484.20 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 8-(2-ethenoxyethoxy)-1,1,1,2,3,3,4,4,5,5,6,6-dodecafluoro-2-(trifluoromethyl)octane |
| SMILES | C=COCCOCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H11F15O2/c1-2-29-5-6-30-4-3-7(14,15)9(17,18)11(21,22)10(19,20)8(16,12(23,24)25)13(26,27)28/h2H,1,3-6H2 |
| InChIKey | WSOSCJATTXCRHG-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.20 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|