C9H10F8O2 — CID 58825814
5-(2-ethenoxyethoxy)-1,1,2,2,3,3,4,4-octafluoropentane (PubChem CID 58825814) has the molecular formula C9H10F8O2 and a molecular weight of 302.16 g/mol. Its IUPAC name is 5-(2-ethenoxyethoxy)-1,1,2,2,3,3,4,4-octafluoropentane.
| Compound Name | 5-(2-ethenoxyethoxy)-1,1,2,2,3,3,4,4-octafluoropentane |
|---|---|
| PubChem CID | 58825814 |
| Molecular Formula | C9H10F8O2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 5-(2-ethenoxyethoxy)-1,1,2,2,3,3,4,4-octafluoropentane |
| SMILES | C=COCCOCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H10F8O2/c1-2-18-3-4-19-5-7(12,13)9(16,17)8(14,15)6(10)11/h2,6H,1,3-5H2 |
| InChIKey | XNTJIWGHNZINRV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|