C14H17F3O6 — CID 58825977
1-[4-(2-methyloxan-3-yl)-2,5-dioxooxolan-3-yl]ethyl 2,2,2-trifluoroacetate (PubChem CID 58825977) has the molecular formula C14H17F3O6 and a molecular weight of 338.28 g/mol. Its IUPAC name is 1-[4-(2-methyloxan-3-yl)-2,5-dioxooxolan-3-yl]ethyl 2,2,2-trifluoroacetate.
| Compound Name | 1-[4-(2-methyloxan-3-yl)-2,5-dioxooxolan-3-yl]ethyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 58825977 |
| Molecular Formula | C14H17F3O6 |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-[4-(2-methyloxan-3-yl)-2,5-dioxooxolan-3-yl]ethyl 2,2,2-trifluoroacetate |
| SMILES | CC1OCCCC1C1C(=O)OC(=O)C1C(C)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H17F3O6/c1-6-8(4-3-5-21-6)10-9(11(18)23-12(10)19)7(2)22-13(20)14(15,16)17/h6-10H,3-5H2,1-2H3 |
| InChIKey | HSRHZKDYHFPOCJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|