C23H42N4O — CID 58826296
2-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone (PubChem CID 58826296) has the molecular formula C23H42N4O and a molecular weight of 390.62 g/mol. Its IUPAC name is 2-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone.
| Compound Name | 2-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 58826296 |
| Molecular Formula | C23H42N4O |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.34 |
| IUPAC Name | 2-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone |
| SMILES | CC1CCN(C2CCN(CC(=O)N3CCC(N4CCCCC4)CC3)CC2)CC1 |
| InChI | InChI=1S/C23H42N4O/c1-20-5-15-26(16-6-20)21-7-13-24(14-8-21)19-23(28)27-17-9-22(10-18-27)25-11-3-2-4-12-25/h20-22H,2-19H2,1H3 |
| InChIKey | RXUUYKNVJCCBAU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |