C14H11ClN2O — CID 58826879
N-(3-chloro-2-methylphenyl)furo[2,3-c]pyridin-3-amine (PubChem CID 58826879) has the molecular formula C14H11ClN2O and a molecular weight of 258.71 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)furo[2,3-c]pyridin-3-amine.
| Compound Name | N-(3-chloro-2-methylphenyl)furo[2,3-c]pyridin-3-amine |
|---|---|
| PubChem CID | 58826879 |
| Molecular Formula | C14H11ClN2O |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)furo[2,3-c]pyridin-3-amine |
| SMILES | Cc1c(Cl)cccc1Nc1coc2cnccc12 |
| InChI | InChI=1S/C14H11ClN2O/c1-9-11(15)3-2-4-12(9)17-13-8-18-14-7-16-6-5-10(13)14/h2-8,17H,1H3 |
| InChIKey | XJDUQMWPCBIOHQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |