About 1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-amine
1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-amine (PubChem CID 58826903) has the molecular formula C15H24N2OSi
and a molecular weight of 276.46 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-amine.
Molecular Properties
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-amine |
| PubChem CID | 58826903 |
| Molecular Formula | C15H24N2OSi |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-amine |
| SMILES | CC(C)(C)[Si](C)(C)ON=C1CCc2cc(N)ccc21 |
| InChI | InChI=1S/C15H24N2OSi/c1-15(2,3)19(4,5)18-17-14-9-6-11-10-12(16)7-8-13(11)14/h7-8,10H,6,9,16H2,1-5H3 |
| InChIKey | HIQQUAUJBOLQLQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-amine?
The IUPAC name of 1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-amine (CID 58826903) is 1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-amine.
What is the SMILES notation for 1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-amine?
The canonical SMILES for 1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-amine is CC(C)(C)[Si](C)(C)ON=C1CCc2cc(N)ccc21.
What is the InChIKey of 1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-amine?
The InChIKey is HIQQUAUJBOLQLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2OSi/c1-15(2,3)19(4,5)18-17-14-9-6-11-10-12(16)7-8-13(11)14/h7-8,10H,6,9,16H2,1-5H3.
What are the key properties of 1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-amine?
1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-amine has a molecular weight of 276.46 g/mol, XLogP of 3.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-amine is sourced from PubChem (CID 58826903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).