C18H17Cl2N — CID 58827019
(4aS,9bR)-6-(2,4-dichlorophenyl)-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-c]pyridine (PubChem CID 58827019) has the molecular formula C18H17Cl2N and a molecular weight of 318.25 g/mol. Its IUPAC name is (4aS,9bR)-6-(2,4-dichlorophenyl)-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-c]pyridine.
| Compound Name | (4aS,9bR)-6-(2,4-dichlorophenyl)-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-c]pyridine |
|---|---|
| PubChem CID | 58827019 |
| Molecular Formula | C18H17Cl2N |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | (4aS,9bR)-6-(2,4-dichlorophenyl)-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-c]pyridine |
| SMILES | Clc1ccc(-c2cccc3c2C[C@H]2CCNC[C@@H]32)c(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2N/c19-12-4-5-15(18(20)9-12)13-2-1-3-14-16(13)8-11-6-7-21-10-17(11)14/h1-5,9,11,17,21H,6-8,10H2/t11-,17-/m1/s1 |
| InChIKey | KZPPFMBFVUYYAY-PIGZYNQJSA-N |
| XLogP | 4.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |