C17H19N3O — CID 58827054
3-butoxy-4-(6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl)benzonitrile (PubChem CID 58827054) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-butoxy-4-(6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl)benzonitrile.
| Compound Name | 3-butoxy-4-(6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl)benzonitrile |
|---|---|
| PubChem CID | 58827054 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 3-butoxy-4-(6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl)benzonitrile |
| SMILES | CCCCOc1cc(C#N)ccc1C1CCc2cncn21 |
| InChI | InChI=1S/C17H19N3O/c1-2-3-8-21-17-9-13(10-18)4-6-15(17)16-7-5-14-11-19-12-20(14)16/h4,6,9,11-12,16H,2-3,5,7-8H2,1H3 |
| InChIKey | ARRNDOIBYYQECU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|