C18H23NO2 — CID 58827464
7-butyl-4-ethyl-1-hepta-1,3,5-triynyl-2,6-dioxa-7-azabicyclo[2.2.2]octane (PubChem CID 58827464) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 7-butyl-4-ethyl-1-hepta-1,3,5-triynyl-2,6-dioxa-7-azabicyclo[2.2.2]octane.
| Compound Name | 7-butyl-4-ethyl-1-hepta-1,3,5-triynyl-2,6-dioxa-7-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 58827464 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 7-butyl-4-ethyl-1-hepta-1,3,5-triynyl-2,6-dioxa-7-azabicyclo[2.2.2]octane |
| SMILES | CC#CC#CC#CC12OCC(CC)(CO1)CN2CCCC |
| InChI | InChI=1S/C18H23NO2/c1-4-7-9-10-11-12-18-19(13-8-5-2)14-17(6-3,15-20-18)16-21-18/h5-6,8,13-16H2,1-3H3 |
| InChIKey | COSGNIWSSZEORR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|