C6H6N2O3 — CID 58827624
1-methyl-5-methylidene-1,3-diazinane-2,4,6-trione (PubChem CID 58827624) has the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. Its IUPAC name is 1-methyl-5-methylidene-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-methyl-5-methylidene-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 58827624 |
| Molecular Formula | C6H6N2O3 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | 1-methyl-5-methylidene-1,3-diazinane-2,4,6-trione |
| SMILES | C=C1C(=O)NC(=O)N(C)C1=O |
| InChI | InChI=1S/C6H6N2O3/c1-3-4(9)7-6(11)8(2)5(3)10/h1H2,2H3,(H,7,9,11) |
| InChIKey | WWYZGWRFYRCHNZ-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|