C27H34N2 — CID 58827661
2,3,4,5-tetramethyl-6-[2,3,4-trimethyl-5-(3,4,5,6-tetramethyl-2-pyridinyl)phenyl]pyridine (PubChem CID 58827661) has the molecular formula C27H34N2 and a molecular weight of 386.58 g/mol. Its IUPAC name is 2,3,4,5-tetramethyl-6-[2,3,4-trimethyl-5-(3,4,5,6-tetramethyl-2-pyridinyl)phenyl]pyridine.
| Compound Name | 2,3,4,5-tetramethyl-6-[2,3,4-trimethyl-5-(3,4,5,6-tetramethyl-2-pyridinyl)phenyl]pyridine |
|---|---|
| PubChem CID | 58827661 |
| Molecular Formula | C27H34N2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 2,3,4,5-tetramethyl-6-[2,3,4-trimethyl-5-(3,4,5,6-tetramethyl-2-pyridinyl)phenyl]pyridine |
| SMILES | Cc1nc(-c2cc(-c3nc(C)c(C)c(C)c3C)c(C)c(C)c2C)c(C)c(C)c1C |
| InChI | InChI=1S/C27H34N2/c1-13-16(4)22(10)28-26(20(13)8)24-12-25(19(7)15(3)18(24)6)27-21(9)14(2)17(5)23(11)29-27/h12H,1-11H3 |
| InChIKey | CLUQSGTVXKQKPD-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |