C55H34N6 — CID 58827727
2-[7'-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9'-spirobi[fluorene]-2'-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 58827727) has the molecular formula C55H34N6 and a molecular weight of 778.92 g/mol. Its IUPAC name is 2-[7'-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9'-spirobi[fluorene]-2'-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[7'-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9'-spirobi[fluorene]-2'-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 58827727 |
| Molecular Formula | C55H34N6 |
| Molecular Weight | 778.92 g/mol |
| Exact Mass | 778.28 |
| IUPAC Name | 2-[7'-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9'-spirobi[fluorene]-2'-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)C3(c5ccccc5-c5ccccc53)c3cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)ccc3-4)n2)cc1 |
| InChI | InChI=1S/C55H34N6/c1-5-17-35(18-6-1)49-56-50(36-19-7-2-8-20-36)59-53(58-49)39-29-31-43-44-32-30-40(54-60-51(37-21-9-3-10-22-37)57-52(61-54)38-23-11-4-12-24-38)34-48(44)55(47(43)33-39)45-27-15-13-25-41(45)42-26-14-16-28-46(42)55/h1-34H |
| InChIKey | HKGFWIMVEQEHKE-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.92 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |