C20H20N4O — CID 58827838
(2Z,4Z)-3-[6-(dimethylamino)naphthalen-2-yl]-5-(2-hydroxyethylamino)-2-isocyanopenta-2,4-dienenitrile (PubChem CID 58827838) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is (2Z,4Z)-3-[6-(dimethylamino)naphthalen-2-yl]-5-(2-hydroxyethylamino)-2-isocyanopenta-2,4-dienenitrile.
| Compound Name | (2Z,4Z)-3-[6-(dimethylamino)naphthalen-2-yl]-5-(2-hydroxyethylamino)-2-isocyanopenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 58827838 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (2Z,4Z)-3-[6-(dimethylamino)naphthalen-2-yl]-5-(2-hydroxyethylamino)-2-isocyanopenta-2,4-dienenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C(/C=C\NCCO)c1ccc2cc(N(C)C)ccc2c1 |
| InChI | InChI=1S/C20H20N4O/c1-22-20(14-21)19(8-9-23-10-11-25)17-5-4-16-13-18(24(2)3)7-6-15(16)12-17/h4-9,12-13,23,25H,10-11H2,2-3H3/b9-8-,20-19- |
| InChIKey | PHOMDKSKDYZANG-DNJGGVDCSA-N |
| XLogP | 3.16 |
| TPSA | 63.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|