C31H39N5O6 — CID 58828156
methyl 2-[[2-(3,5-dimethylphenyl)-6-isocyano-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl]oxycarbonyl-(2-methoxy-2-oxoethyl)amino]acetate (PubChem CID 58828156) has the molecular formula C31H39N5O6 and a molecular weight of 577.68 g/mol. Its IUPAC name is methyl 2-[[2-(3,5-dimethylphenyl)-6-isocyano-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl]oxycarbonyl-(2-methoxy-2-oxoethyl)amino]acetate.
| Compound Name | methyl 2-[[2-(3,5-dimethylphenyl)-6-isocyano-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl]oxycarbonyl-(2-methoxy-2-oxoethyl)amino]acetate |
|---|---|
| PubChem CID | 58828156 |
| Molecular Formula | C31H39N5O6 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | methyl 2-[[2-(3,5-dimethylphenyl)-6-isocyano-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl]oxycarbonyl-(2-methoxy-2-oxoethyl)amino]acetate |
| SMILES | [C-]#[N+]c1c(CC2C(C)CC(C)CC2C)c2nc(-c3cc(C)cc(C)c3)[nH]n2c1OC(=O)N(CC(=O)OC)CC(=O)OC |
| InChI | InChI=1S/C31H39N5O6/c1-17-9-18(2)13-22(12-17)28-33-29-24(14-23-20(4)10-19(3)11-21(23)5)27(32-6)30(36(29)34-28)42-31(39)35(15-25(37)40-7)16-26(38)41-8/h9,12-13,19-21,23H,10-11,14-16H2,1-5,7-8H3,(H,33,34) |
| InChIKey | AKHNLYPCXCBPQA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|