About CID 58828389
CID 58828389 (PubChem CID 58828389) has the molecular formula C49H45N6O4Si2
and a molecular weight of 838.11 g/mol.
Molecular Properties
| Compound Name | CID 58828389 |
| PubChem CID | 58828389 |
| Molecular Formula | C49H45N6O4Si2 |
| Molecular Weight | 838.11 g/mol |
| Exact Mass | 837.30 |
| IUPAC Name | — |
| SMILES | C[Si](C)CC#Cc1ccc2c(c1)C(c1ccccc1)=NCc1c(C(=O)OCCCOC(=O)c3ncn4c3CN=C(c3ccccc3)c3cc(C#C[Si](C)(C)C)ccc3-4)ncn1-2 |
| InChI | InChI=1S/C49H45N6O4Si2/c1-60(2)26-12-14-34-19-21-40-38(28-34)44(36-15-8-6-9-16-36)50-30-42-46(52-32-54(40)42)48(56)58-24-13-25-59-49(57)47-43-31-51-45(37-17-10-7-11-18-37)39-29-35(23-27-61(3,4)5)20-22-41(39)55(43)33-53-47/h6-11,15-22,28-29,32-33H,13,24-26,30-31H2,1-5H3 |
| InChIKey | UCUZNIISHYLQCW-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 112.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 838.11 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 58828389 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58828389?
The IUPAC name of CID 58828389 (CID 58828389) is not available.
What is the SMILES notation for CID 58828389?
The canonical SMILES for CID 58828389 is C[Si](C)CC#Cc1ccc2c(c1)C(c1ccccc1)=NCc1c(C(=O)OCCCOC(=O)c3ncn4c3CN=C(c3ccccc3)c3cc(C#C[Si](C)(C)C)ccc3-4)ncn1-2.
What is the InChIKey of CID 58828389?
The InChIKey is UCUZNIISHYLQCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C49H45N6O4Si2/c1-60(2)26-12-14-34-19-21-40-38(28-34)44(36-15-8-6-9-16-36)50-30-42-46(52-32-54(40)42)48(56)58-24-13-25-59-49(57)47-43-31-51-45(37-17-10-7-11-18-37)39-29-35(23-27-61(3,4)5)20-22-41(39)55(43)33-53-47/h6-11,15-22,28-29,32-33H,13,24-26,30-31H2,1-5H3.
What are the key properties of CID 58828389?
CID 58828389 has a molecular weight of 838.11 g/mol, XLogP of 8.50, 9 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58828389 is sourced from PubChem (CID 58828389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).