C30H52O2SSi — CID 58828455
(6R)-6-[(4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methyl-7-phenylsulfanylheptan-2-ol (PubChem CID 58828455) has the molecular formula C30H52O2SSi and a molecular weight of 504.90 g/mol. Its IUPAC name is (6R)-6-[(4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methyl-7-phenylsulfanylheptan-2-ol.
| Compound Name | (6R)-6-[(4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methyl-7-phenylsulfanylheptan-2-ol |
|---|---|
| PubChem CID | 58828455 |
| Molecular Formula | C30H52O2SSi |
| Molecular Weight | 504.90 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | (6R)-6-[(4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methyl-7-phenylsulfanylheptan-2-ol |
| SMILES | CC(C)(O)CCC[C@@H](CSc1ccccc1)C1CCC2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C30H52O2SSi/c1-28(2,3)34(7,8)32-27-17-13-21-30(6)25(18-19-26(27)30)23(14-12-20-29(4,5)31)22-33-24-15-10-9-11-16-24/h9-11,15-16,23,25-27,31H,12-14,17-22H2,1-8H3/t23-,25?,26?,27-,30+/m0/s1 |
| InChIKey | RTBKHVUIQFHSCX-RVHCDZNQSA-N |
| XLogP | 8.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.90 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|