C22H36OSi — CID 58828473
[(4S,7aS)-7a-methyl-1-(1-prop-2-ynylcyclopropyl)-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 58828473) has the molecular formula C22H36OSi and a molecular weight of 344.62 g/mol. Its IUPAC name is [(4S,7aS)-7a-methyl-1-(1-prop-2-ynylcyclopropyl)-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4S,7aS)-7a-methyl-1-(1-prop-2-ynylcyclopropyl)-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 58828473 |
| Molecular Formula | C22H36OSi |
| Molecular Weight | 344.62 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | [(4S,7aS)-7a-methyl-1-(1-prop-2-ynylcyclopropyl)-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C#CCC1(C2=CCC3[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]23C)CC1 |
| InChI | InChI=1S/C22H36OSi/c1-8-13-22(15-16-22)19-12-11-17-18(10-9-14-21(17,19)5)23-24(6,7)20(2,3)4/h1,12,17-18H,9-11,13-16H2,2-7H3/t17?,18-,21-/m0/s1 |
| InChIKey | VYPSWKZGPAVKBJ-VLQCZPCNSA-N |
| XLogP | 6.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.62 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|