C21H24Cl2N4 — CID 58829176
N-[6-(2,6-dichlorophenyl)quinazolin-2-yl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 58829176) has the molecular formula C21H24Cl2N4 and a molecular weight of 403.36 g/mol. Its IUPAC name is N-[6-(2,6-dichlorophenyl)quinazolin-2-yl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[6-(2,6-dichlorophenyl)quinazolin-2-yl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 58829176 |
| Molecular Formula | C21H24Cl2N4 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-[6-(2,6-dichlorophenyl)quinazolin-2-yl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1ncc2cc(-c3c(Cl)cccc3Cl)ccc2n1 |
| InChI | InChI=1S/C21H24Cl2N4/c1-3-27(4-2)12-6-11-24-21-25-14-16-13-15(9-10-19(16)26-21)20-17(22)7-5-8-18(20)23/h5,7-10,13-14H,3-4,6,11-12H2,1-2H3,(H,24,25,26) |
| InChIKey | NUWSPBDCENRQOH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|