C12H12NO- — CID 58830972
3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-olate (PubChem CID 58830972) has the molecular formula C12H12NO- and a molecular weight of 186.23 g/mol. Its IUPAC name is 3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-olate.
| Compound Name | 3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-olate |
|---|---|
| PubChem CID | 58830972 |
| Molecular Formula | C12H12NO- |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-olate |
| SMILES | [O-]C1=NCC2CCCc3cccc1c32 |
| InChI | InChI=1S/C12H13NO/c14-12-10-6-2-4-8-3-1-5-9(7-13-12)11(8)10/h2,4,6,9H,1,3,5,7H2,(H,13,14)/p-1 |
| InChIKey | LIYNNEXXAUJWRU-UHFFFAOYSA-M |
| XLogP | 1.23 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |