C63H39N15 — CID 58831202
4,9,14-triphenyl-3,8,13-tris(3-phenylimidazo[4,5-b]pyridin-2-yl)-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaene (PubChem CID 58831202) has the molecular formula C63H39N15 and a molecular weight of 1006.11 g/mol. Its IUPAC name is 4,9,14-triphenyl-3,8,13-tris(3-phenylimidazo[4,5-b]pyridin-2-yl)-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaene.
| Compound Name | 4,9,14-triphenyl-3,8,13-tris(3-phenylimidazo[4,5-b]pyridin-2-yl)-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaene |
|---|---|
| PubChem CID | 58831202 |
| Molecular Formula | C63H39N15 |
| Molecular Weight | 1006.11 g/mol |
| Exact Mass | 1005.35 |
| IUPAC Name | 4,9,14-triphenyl-3,8,13-tris(3-phenylimidazo[4,5-b]pyridin-2-yl)-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaene |
| SMILES | c1ccc(-c2nn3c(c2-c2nc4cccnc4n2-c2ccccc2)n2nc(-c4ccccc4)c(-c4nc5cccnc5n4-c4ccccc4)c2n2nc(-c4ccccc4)c(-c4nc5cccnc5n4-c4ccccc4)c32)cc1 |
| InChI | InChI=1S/C63H39N15/c1-7-22-40(23-8-1)52-49(58-67-46-34-19-37-64-55(46)73(58)43-28-13-4-14-29-43)61-76(70-52)62-50(59-68-47-35-20-38-65-56(47)74(59)44-30-15-5-16-31-44)53(41-24-9-2-10-25-41)72-78(62)63-51(54(71-77(61)63)42-26-11-3-12-27-42)60-69-48-36-21-39-66-57(48)75(60)45-32-17-6-18-33-45/h1-39H |
| InChIKey | LHCMIHIQDGCZHG-UHFFFAOYSA-N |
| XLogP | 12.83 |
| TPSA | 144.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1006.11 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |