C32H20N10 — CID 58831211
6-[8-(4-cyanophenyl)-13-(4-isocyanophenyl)-4,9,14-trimethyl-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaen-3-yl]pyridine-3-carbonitrile (PubChem CID 58831211) has the molecular formula C32H20N10 and a molecular weight of 544.58 g/mol. Its IUPAC name is 6-[8-(4-cyanophenyl)-13-(4-isocyanophenyl)-4,9,14-trimethyl-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaen-3-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[8-(4-cyanophenyl)-13-(4-isocyanophenyl)-4,9,14-trimethyl-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaen-3-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 58831211 |
| Molecular Formula | C32H20N10 |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | 6-[8-(4-cyanophenyl)-13-(4-isocyanophenyl)-4,9,14-trimethyl-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaen-3-yl]pyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2c(C)nn3c2n2nc(C)c(-c4ccc(C#N)cc4)c2n2nc(C)c(-c4ccc(C#N)cn4)c32)cc1 |
| InChI | InChI=1S/C32H20N10/c1-18-27(23-8-5-21(15-33)6-9-23)30-40(37-18)31-28(24-10-12-25(35-4)13-11-24)19(2)38-41(31)32-29(20(3)39-42(30)32)26-14-7-22(16-34)17-36-26/h5-14,17H,1-3H3 |
| InChIKey | PFGYCPFBJOYFFM-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 116.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|