C19H24O8 — CID 58831356
2-ethyl-5-[5-(2-ethyl-4-hydroxy-2-methyl-6-oxo-1,3-dioxan-5-yl)penta-2,4-dienylidene]-2-methyl-1,3-dioxane-4,6-dione (PubChem CID 58831356) has the molecular formula C19H24O8 and a molecular weight of 380.39 g/mol. Its IUPAC name is 2-ethyl-5-[5-(2-ethyl-4-hydroxy-2-methyl-6-oxo-1,3-dioxan-5-yl)penta-2,4-dienylidene]-2-methyl-1,3-dioxane-4,6-dione.
| Compound Name | 2-ethyl-5-[5-(2-ethyl-4-hydroxy-2-methyl-6-oxo-1,3-dioxan-5-yl)penta-2,4-dienylidene]-2-methyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 58831356 |
| Molecular Formula | C19H24O8 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-ethyl-5-[5-(2-ethyl-4-hydroxy-2-methyl-6-oxo-1,3-dioxan-5-yl)penta-2,4-dienylidene]-2-methyl-1,3-dioxane-4,6-dione |
| SMILES | CCC1(C)OC(=O)C(=CC=CC=CC2C(=O)OC(C)(CC)OC2O)C(=O)O1 |
| InChI | InChI=1S/C19H24O8/c1-5-18(3)24-14(20)12(15(21)25-18)10-8-7-9-11-13-16(22)26-19(4,6-2)27-17(13)23/h7-12,14,20H,5-6H2,1-4H3/b9-7?,10-8?,13-11- |
| InChIKey | HBKATEGTHLTYJF-RSHKHRPWSA-N |
| XLogP | 1.89 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|