C36H41N5O6S — CID 58831524
cyclopentyl N-[(1S,4S,7Z,14R,18R)-4-formyl-2,15-dioxo-18-(3-thiophen-2-ylquinoxalin-2-yl)oxy-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate (PubChem CID 58831524) has the molecular formula C36H41N5O6S and a molecular weight of 671.82 g/mol. Its IUPAC name is cyclopentyl N-[(1S,4S,7Z,14R,18R)-4-formyl-2,15-dioxo-18-(3-thiophen-2-ylquinoxalin-2-yl)oxy-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate.
| Compound Name | cyclopentyl N-[(1S,4S,7Z,14R,18R)-4-formyl-2,15-dioxo-18-(3-thiophen-2-ylquinoxalin-2-yl)oxy-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
|---|---|
| PubChem CID | 58831524 |
| Molecular Formula | C36H41N5O6S |
| Molecular Weight | 671.82 g/mol |
| Exact Mass | 671.28 |
| IUPAC Name | cyclopentyl N-[(1S,4S,7Z,14R,18R)-4-formyl-2,15-dioxo-18-(3-thiophen-2-ylquinoxalin-2-yl)oxy-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
| SMILES | O=C[C@]12CC1/C=C\CCCCC[C@@H](NC(=O)OC1CCCC1)C(=O)N1C[C@H](Oc3nc4ccccc4nc3-c3cccs3)C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C36H41N5O6S/c42-22-36-20-23(36)11-4-2-1-3-5-16-28(39-35(45)47-24-12-6-7-13-24)34(44)41-21-25(19-29(41)32(43)40-36)46-33-31(30-17-10-18-48-30)37-26-14-8-9-15-27(26)38-33/h4,8-11,14-15,17-18,22-25,28-29H,1-3,5-7,12-13,16,19-21H2,(H,39,45)(H,40,43)/b11-4-/t23?,25-,28-,29+,36-/m1/s1 |
| InChIKey | HGWXGOAZFVNXLM-WCFHNHFDSA-N |
| XLogP | 5.34 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.82 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|