C14H24BNO2 — CID 58831629
(2R)-2-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine (PubChem CID 58831629) has the molecular formula C14H24BNO2 and a molecular weight of 249.16 g/mol. Its IUPAC name is (2R)-2-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine.
| Compound Name | (2R)-2-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine |
|---|---|
| PubChem CID | 58831629 |
| Molecular Formula | C14H24BNO2 |
| Molecular Weight | 249.16 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | (2R)-2-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine |
| SMILES | CC1(C)C2C[C@H]3OB([C@@H]4CCCN4)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C14H24BNO2/c1-13(2)9-7-10(13)14(3)11(8-9)17-15(18-14)12-5-4-6-16-12/h9-12,16H,4-8H2,1-3H3/t9?,10-,11+,12-,14-/m0/s1 |
| InChIKey | QWXSWNPNLGZAGQ-AJGGJRPISA-N |
| XLogP | 2.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.16 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|