About (2S)-3-methoxy-2,4-dimethyl-2H-furan-5-one
(2S)-3-methoxy-2,4-dimethyl-2H-furan-5-one (PubChem CID 58831740) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is (2S)-3-methoxy-2,4-dimethyl-2H-furan-5-one.
Molecular Properties
| Compound Name | (2S)-3-methoxy-2,4-dimethyl-2H-furan-5-one |
| PubChem CID | 58831740 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (2S)-3-methoxy-2,4-dimethyl-2H-furan-5-one |
| SMILES | COC1=C(C)C(=O)O[C@H]1C |
| InChI | InChI=1S/C7H10O3/c1-4-6(9-3)5(2)10-7(4)8/h5H,1-3H3/t5-/m0/s1 |
| InChIKey | MJMOVENCVKUZOG-YFKPBYRVSA-N |
| XLogP | 0.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-3-methoxy-2,4-dimethyl-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-methoxy-2,4-dimethyl-2H-furan-5-one?
The IUPAC name of (2S)-3-methoxy-2,4-dimethyl-2H-furan-5-one (CID 58831740) is (2S)-3-methoxy-2,4-dimethyl-2H-furan-5-one.
What is the SMILES notation for (2S)-3-methoxy-2,4-dimethyl-2H-furan-5-one?
The canonical SMILES for (2S)-3-methoxy-2,4-dimethyl-2H-furan-5-one is COC1=C(C)C(=O)O[C@H]1C.
What is the InChIKey of (2S)-3-methoxy-2,4-dimethyl-2H-furan-5-one?
The InChIKey is MJMOVENCVKUZOG-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H10O3/c1-4-6(9-3)5(2)10-7(4)8/h5H,1-3H3/t5-/m0/s1.
What are the key properties of (2S)-3-methoxy-2,4-dimethyl-2H-furan-5-one?
(2S)-3-methoxy-2,4-dimethyl-2H-furan-5-one has a molecular weight of 142.15 g/mol, XLogP of 0.85, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-methoxy-2,4-dimethyl-2H-furan-5-one is sourced from PubChem (CID 58831740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).