About N-ethyl-N-methyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide
N-ethyl-N-methyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide (PubChem CID 58831869) has the molecular formula C7H16N2O4S2
and a molecular weight of 256.35 g/mol. Its IUPAC name is N-ethyl-N-methyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide.
Molecular Properties
| Compound Name | N-ethyl-N-methyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide |
| PubChem CID | 58831869 |
| Molecular Formula | C7H16N2O4S2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | N-ethyl-N-methyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide |
| SMILES | CCN(C)S(=O)(=O)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C7H16N2O4S2/c1-3-8(2)15(12,13)9-4-6-14(10,11)7-5-9/h3-7H2,1-2H3 |
| InChIKey | ASOAFPSXWFJPML-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-N-methyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide?
The IUPAC name of N-ethyl-N-methyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide (CID 58831869) is N-ethyl-N-methyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide.
What is the SMILES notation for N-ethyl-N-methyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide?
The canonical SMILES for N-ethyl-N-methyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide is CCN(C)S(=O)(=O)N1CCS(=O)(=O)CC1.
What is the InChIKey of N-ethyl-N-methyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide?
The InChIKey is ASOAFPSXWFJPML-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O4S2/c1-3-8(2)15(12,13)9-4-6-14(10,11)7-5-9/h3-7H2,1-2H3.
What are the key properties of N-ethyl-N-methyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide?
N-ethyl-N-methyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide has a molecular weight of 256.35 g/mol, XLogP of -1.09, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide is sourced from PubChem (CID 58831869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).