About (5-ethyl-1,4-dihydropyrimidin-2-yl)-methanidylazanium
(5-ethyl-1,4-dihydropyrimidin-2-yl)-methanidylazanium (PubChem CID 58832406) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is (5-ethyl-1,4-dihydropyrimidin-2-yl)-methanidylazanium.
Molecular Properties
| Compound Name | (5-ethyl-1,4-dihydropyrimidin-2-yl)-methanidylazanium |
| PubChem CID | 58832406 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | (5-ethyl-1,4-dihydropyrimidin-2-yl)-methanidylazanium |
| SMILES | [CH2-][NH2+]C1=NCC(CC)=CN1 |
| InChI | InChI=1S/C7H13N3/c1-3-6-4-9-7(8-2)10-5-6/h4H,2-3,5,8H2,1H3,(H,9,10) |
| InChIKey | BJLMIVMWBMVCHZ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 41.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (5-ethyl-1,4-dihydropyrimidin-2-yl)-methanidylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-1,4-dihydropyrimidin-2-yl)-methanidylazanium?
The IUPAC name of (5-ethyl-1,4-dihydropyrimidin-2-yl)-methanidylazanium (CID 58832406) is (5-ethyl-1,4-dihydropyrimidin-2-yl)-methanidylazanium.
What is the SMILES notation for (5-ethyl-1,4-dihydropyrimidin-2-yl)-methanidylazanium?
The canonical SMILES for (5-ethyl-1,4-dihydropyrimidin-2-yl)-methanidylazanium is [CH2-][NH2+]C1=NCC(CC)=CN1.
What is the InChIKey of (5-ethyl-1,4-dihydropyrimidin-2-yl)-methanidylazanium?
The InChIKey is BJLMIVMWBMVCHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3/c1-3-6-4-9-7(8-2)10-5-6/h4H,2-3,5,8H2,1H3,(H,9,10).
What are the key properties of (5-ethyl-1,4-dihydropyrimidin-2-yl)-methanidylazanium?
(5-ethyl-1,4-dihydropyrimidin-2-yl)-methanidylazanium has a molecular weight of 139.20 g/mol, XLogP of -0.41, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-1,4-dihydropyrimidin-2-yl)-methanidylazanium is sourced from PubChem (CID 58832406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).