C23H44O — CID 58833433
2,2,3,3,4,5,6-heptamethyl-4-(2,3,3,4-tetramethylpentan-2-yl)cyclohexane-1-carbaldehyde (PubChem CID 58833433) has the molecular formula C23H44O and a molecular weight of 336.60 g/mol. Its IUPAC name is 2,2,3,3,4,5,6-heptamethyl-4-(2,3,3,4-tetramethylpentan-2-yl)cyclohexane-1-carbaldehyde.
| Compound Name | 2,2,3,3,4,5,6-heptamethyl-4-(2,3,3,4-tetramethylpentan-2-yl)cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 58833433 |
| Molecular Formula | C23H44O |
| Molecular Weight | 336.60 g/mol |
| Exact Mass | 336.34 |
| IUPAC Name | 2,2,3,3,4,5,6-heptamethyl-4-(2,3,3,4-tetramethylpentan-2-yl)cyclohexane-1-carbaldehyde |
| SMILES | CC1C(C=O)C(C)(C)C(C)(C)C(C)(C(C)(C)C(C)(C)C(C)C)C1C |
| InChI | InChI=1S/C23H44O/c1-15(2)19(5,6)21(9,10)23(13)17(4)16(3)18(14-24)20(7,8)22(23,11)12/h14-18H,1-13H3 |
| InChIKey | FRTSCAWZAUUZCZ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.60 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|