About N-methyl-N,9-bis(trimethylsilyl)purin-6-amine
N-methyl-N,9-bis(trimethylsilyl)purin-6-amine (PubChem CID 58834014) has the molecular formula C12H23N5Si2
and a molecular weight of 293.52 g/mol. Its IUPAC name is N-methyl-N,9-bis(trimethylsilyl)purin-6-amine.
Molecular Properties
| Compound Name | N-methyl-N,9-bis(trimethylsilyl)purin-6-amine |
| PubChem CID | 58834014 |
| Molecular Formula | C12H23N5Si2 |
| Molecular Weight | 293.52 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-methyl-N,9-bis(trimethylsilyl)purin-6-amine |
| SMILES | CN(c1ncnc2c1ncn2[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C12H23N5Si2/c1-16(18(2,3)4)11-10-12(14-8-13-11)17(9-15-10)19(5,6)7/h8-9H,1-7H3 |
| InChIKey | QUFIYYHDESVHAM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N,9-bis(trimethylsilyl)purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N,9-bis(trimethylsilyl)purin-6-amine?
The IUPAC name of N-methyl-N,9-bis(trimethylsilyl)purin-6-amine (CID 58834014) is N-methyl-N,9-bis(trimethylsilyl)purin-6-amine.
What is the SMILES notation for N-methyl-N,9-bis(trimethylsilyl)purin-6-amine?
The canonical SMILES for N-methyl-N,9-bis(trimethylsilyl)purin-6-amine is CN(c1ncnc2c1ncn2[Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of N-methyl-N,9-bis(trimethylsilyl)purin-6-amine?
The InChIKey is QUFIYYHDESVHAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N5Si2/c1-16(18(2,3)4)11-10-12(14-8-13-11)17(9-15-10)19(5,6)7/h8-9H,1-7H3.
What are the key properties of N-methyl-N,9-bis(trimethylsilyl)purin-6-amine?
N-methyl-N,9-bis(trimethylsilyl)purin-6-amine has a molecular weight of 293.52 g/mol, XLogP of 2.78, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N,9-bis(trimethylsilyl)purin-6-amine is sourced from PubChem (CID 58834014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).