About (2R,3R)-4-azido-2-ethyl-3,5-dimethyloxolane
(2R,3R)-4-azido-2-ethyl-3,5-dimethyloxolane (PubChem CID 58834030) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is (2R,3R)-4-azido-2-ethyl-3,5-dimethyloxolane.
Molecular Properties
| Compound Name | (2R,3R)-4-azido-2-ethyl-3,5-dimethyloxolane |
| PubChem CID | 58834030 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | (2R,3R)-4-azido-2-ethyl-3,5-dimethyloxolane |
| SMILES | CC[C@H]1OC(C)C(N=[N+]=[N-])[C@H]1C |
| InChI | InChI=1S/C8H15N3O/c1-4-7-5(2)8(10-11-9)6(3)12-7/h5-8H,4H2,1-3H3/t5-,6?,7+,8?/m0/s1 |
| InChIKey | OQWTUTZKYDSZRQ-AEMDVCDZSA-N |
| XLogP | 2.50 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-4-azido-2-ethyl-3,5-dimethyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-4-azido-2-ethyl-3,5-dimethyloxolane?
The IUPAC name of (2R,3R)-4-azido-2-ethyl-3,5-dimethyloxolane (CID 58834030) is (2R,3R)-4-azido-2-ethyl-3,5-dimethyloxolane.
What is the SMILES notation for (2R,3R)-4-azido-2-ethyl-3,5-dimethyloxolane?
The canonical SMILES for (2R,3R)-4-azido-2-ethyl-3,5-dimethyloxolane is CC[C@H]1OC(C)C(N=[N+]=[N-])[C@H]1C.
What is the InChIKey of (2R,3R)-4-azido-2-ethyl-3,5-dimethyloxolane?
The InChIKey is OQWTUTZKYDSZRQ-AEMDVCDZSA-N. The full InChI is InChI=1S/C8H15N3O/c1-4-7-5(2)8(10-11-9)6(3)12-7/h5-8H,4H2,1-3H3/t5-,6?,7+,8?/m0/s1.
What are the key properties of (2R,3R)-4-azido-2-ethyl-3,5-dimethyloxolane?
(2R,3R)-4-azido-2-ethyl-3,5-dimethyloxolane has a molecular weight of 169.23 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-4-azido-2-ethyl-3,5-dimethyloxolane is sourced from PubChem (CID 58834030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).