C27H36O5 — CID 58834282
ethyl (10R,13S,17R)-3-methoxy-3',10,13-trimethyl-2'-oxospiro[1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-3'-carboxylate (PubChem CID 58834282) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is ethyl (10R,13S,17R)-3-methoxy-3',10,13-trimethyl-2'-oxospiro[1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-3'-carboxylate.
| Compound Name | ethyl (10R,13S,17R)-3-methoxy-3',10,13-trimethyl-2'-oxospiro[1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-3'-carboxylate |
|---|---|
| PubChem CID | 58834282 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | ethyl (10R,13S,17R)-3-methoxy-3',10,13-trimethyl-2'-oxospiro[1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-3'-carboxylate |
| SMILES | CCOC(=O)C1(C)C[C@@]2(CCC3C4CC=C5C=C(OC)CC[C@]5(C)C4=CC[C@@]32C)OC1=O |
| InChI | InChI=1S/C27H36O5/c1-6-31-22(28)25(3)16-27(32-23(25)29)14-11-21-19-8-7-17-15-18(30-5)9-12-24(17,2)20(19)10-13-26(21,27)4/h7,10,15,19,21H,6,8-9,11-14,16H2,1-5H3/t19?,21?,24-,25?,26-,27+/m0/s1 |
| InChIKey | PQBWJZGYQOHEEE-XFUPJBQISA-N |
| XLogP | 5.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|