About 4-(3,4-difluorophenyl)-1,3-oxazole
4-(3,4-difluorophenyl)-1,3-oxazole (PubChem CID 58834806) has the molecular formula C9H5F2NO
and a molecular weight of 181.14 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 4-(3,4-difluorophenyl)-1,3-oxazole |
| PubChem CID | 58834806 |
| Molecular Formula | C9H5F2NO |
| Molecular Weight | 181.14 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 4-(3,4-difluorophenyl)-1,3-oxazole |
| SMILES | Fc1ccc(-c2cocn2)cc1F |
| InChI | InChI=1S/C9H5F2NO/c10-7-2-1-6(3-8(7)11)9-4-13-5-12-9/h1-5H |
| InChIKey | OZTZVVHFRHVHSP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.14 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,4-difluorophenyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-difluorophenyl)-1,3-oxazole?
The IUPAC name of 4-(3,4-difluorophenyl)-1,3-oxazole (CID 58834806) is 4-(3,4-difluorophenyl)-1,3-oxazole.
What is the SMILES notation for 4-(3,4-difluorophenyl)-1,3-oxazole?
The canonical SMILES for 4-(3,4-difluorophenyl)-1,3-oxazole is Fc1ccc(-c2cocn2)cc1F.
What is the InChIKey of 4-(3,4-difluorophenyl)-1,3-oxazole?
The InChIKey is OZTZVVHFRHVHSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F2NO/c10-7-2-1-6(3-8(7)11)9-4-13-5-12-9/h1-5H.
What are the key properties of 4-(3,4-difluorophenyl)-1,3-oxazole?
4-(3,4-difluorophenyl)-1,3-oxazole has a molecular weight of 181.14 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-difluorophenyl)-1,3-oxazole is sourced from PubChem (CID 58834806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).