About 2-(dibutylamino)-1-(8,10-dichlorobenzo[h]isoquinolin-6-yl)ethanol
2-(dibutylamino)-1-(8,10-dichlorobenzo[h]isoquinolin-6-yl)ethanol (PubChem CID 588361) has the molecular formula C23H28Cl2N2O
and a molecular weight of 419.40 g/mol. Its IUPAC name is 2-(dibutylamino)-1-(8,10-dichlorobenzo[h]isoquinolin-6-yl)ethanol.
Molecular Properties
| Compound Name | 2-(dibutylamino)-1-(8,10-dichlorobenzo[h]isoquinolin-6-yl)ethanol |
| PubChem CID | 588361 |
| Molecular Formula | C23H28Cl2N2O |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-(dibutylamino)-1-(8,10-dichlorobenzo[h]isoquinolin-6-yl)ethanol |
| SMILES | CCCCN(CCCC)CC(O)c1cc2ccncc2c2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C23H28Cl2N2O/c1-3-5-9-27(10-6-4-2)15-22(28)18-11-16-7-8-26-14-20(16)23-19(18)12-17(24)13-21(23)25/h7-8,11-14,22,28H,3-6,9-10,15H2,1-2H3 |
| InChIKey | INMSLSIRKJWEFP-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(dibutylamino)-1-(8,10-dichlorobenzo[h]isoquinolin-6-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dibutylamino)-1-(8,10-dichlorobenzo[h]isoquinolin-6-yl)ethanol?
The IUPAC name of 2-(dibutylamino)-1-(8,10-dichlorobenzo[h]isoquinolin-6-yl)ethanol (CID 588361) is 2-(dibutylamino)-1-(8,10-dichlorobenzo[h]isoquinolin-6-yl)ethanol.
What is the SMILES notation for 2-(dibutylamino)-1-(8,10-dichlorobenzo[h]isoquinolin-6-yl)ethanol?
The canonical SMILES for 2-(dibutylamino)-1-(8,10-dichlorobenzo[h]isoquinolin-6-yl)ethanol is CCCCN(CCCC)CC(O)c1cc2ccncc2c2c(Cl)cc(Cl)cc12.
What is the InChIKey of 2-(dibutylamino)-1-(8,10-dichlorobenzo[h]isoquinolin-6-yl)ethanol?
The InChIKey is INMSLSIRKJWEFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28Cl2N2O/c1-3-5-9-27(10-6-4-2)15-22(28)18-11-16-7-8-26-14-20(16)23-19(18)12-17(24)13-21(23)25/h7-8,11-14,22,28H,3-6,9-10,15H2,1-2H3.
What are the key properties of 2-(dibutylamino)-1-(8,10-dichlorobenzo[h]isoquinolin-6-yl)ethanol?
2-(dibutylamino)-1-(8,10-dichlorobenzo[h]isoquinolin-6-yl)ethanol has a molecular weight of 419.40 g/mol, XLogP of 6.63, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dibutylamino)-1-(8,10-dichlorobenzo[h]isoquinolin-6-yl)ethanol is sourced from PubChem (CID 588361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).