C59H60N3O2+ — CID 58836348
[(2E,5E)-2,5-bis[2-[1-[2-(4-methoxyphenyl)ethyl]-3,3-dimethylindol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium (PubChem CID 58836348) has the molecular formula C59H60N3O2+ and a molecular weight of 843.15 g/mol. Its IUPAC name is [(2E,5E)-2,5-bis[2-[1-[2-(4-methoxyphenyl)ethyl]-3,3-dimethylindol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium.
| Compound Name | [(2E,5E)-2,5-bis[2-[1-[2-(4-methoxyphenyl)ethyl]-3,3-dimethylindol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium |
|---|---|
| PubChem CID | 58836348 |
| Molecular Formula | C59H60N3O2+ |
| Molecular Weight | 843.15 g/mol |
| Exact Mass | 842.47 |
| IUPAC Name | [(2E,5E)-2,5-bis[2-[1-[2-(4-methoxyphenyl)ethyl]-3,3-dimethylindol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium |
| SMILES | COc1ccc(CCN2C(=C/C=C3\CC/C(=C\C=C4N(CCc5ccc(OC)cc5)c5ccccc5C4(C)C)C3=[N+](c3ccccc3)c3ccccc3)C(C)(C)c3ccccc32)cc1 |
| InChI | InChI=1S/C59H60N3O2/c1-58(2)51-21-13-15-23-53(51)60(41-39-43-25-33-49(63-5)34-26-43)55(58)37-31-45-29-30-46(57(45)62(47-17-9-7-10-18-47)48-19-11-8-12-20-48)32-38-56-59(3,4)52-22-14-16-24-54(52)61(56)42-40-44-27-35-50(64-6)36-28-44/h7-28,31-38H,29-30,39-42H2,1-6H3/q+1 |
| InChIKey | XGXSSHNTNRFAHY-UHFFFAOYSA-N |
| XLogP | 13.47 |
| TPSA | 27.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.15 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|