About (Z)-4-[[5,6-bis(methylamino)-6-oxohexyl]amino]-2-methyl-4-oxobut-2-enoic acid
(Z)-4-[[5,6-bis(methylamino)-6-oxohexyl]amino]-2-methyl-4-oxobut-2-enoic acid (PubChem CID 58836423) has the molecular formula C13H23N3O4
and a molecular weight of 285.34 g/mol. Its IUPAC name is (Z)-4-[[5,6-bis(methylamino)-6-oxohexyl]amino]-2-methyl-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | (Z)-4-[[5,6-bis(methylamino)-6-oxohexyl]amino]-2-methyl-4-oxobut-2-enoic acid |
| PubChem CID | 58836423 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (Z)-4-[[5,6-bis(methylamino)-6-oxohexyl]amino]-2-methyl-4-oxobut-2-enoic acid |
| SMILES | CNC(=O)C(CCCCNC(=O)/C=C(/C)C(=O)O)NC |
| InChI | InChI=1S/C13H23N3O4/c1-9(13(19)20)8-11(17)16-7-5-4-6-10(14-2)12(18)15-3/h8,10,14H,4-7H2,1-3H3,(H,15,18)(H,16,17)(H,19,20)/b9-8- |
| InChIKey | BQDYQRFPCRZVNW-HJWRWDBZSA-N |
| XLogP | -0.36 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-[[5,6-bis(methylamino)-6-oxohexyl]amino]-2-methyl-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-[[5,6-bis(methylamino)-6-oxohexyl]amino]-2-methyl-4-oxobut-2-enoic acid?
The IUPAC name of (Z)-4-[[5,6-bis(methylamino)-6-oxohexyl]amino]-2-methyl-4-oxobut-2-enoic acid (CID 58836423) is (Z)-4-[[5,6-bis(methylamino)-6-oxohexyl]amino]-2-methyl-4-oxobut-2-enoic acid.
What is the SMILES notation for (Z)-4-[[5,6-bis(methylamino)-6-oxohexyl]amino]-2-methyl-4-oxobut-2-enoic acid?
The canonical SMILES for (Z)-4-[[5,6-bis(methylamino)-6-oxohexyl]amino]-2-methyl-4-oxobut-2-enoic acid is CNC(=O)C(CCCCNC(=O)/C=C(/C)C(=O)O)NC.
What is the InChIKey of (Z)-4-[[5,6-bis(methylamino)-6-oxohexyl]amino]-2-methyl-4-oxobut-2-enoic acid?
The InChIKey is BQDYQRFPCRZVNW-HJWRWDBZSA-N. The full InChI is InChI=1S/C13H23N3O4/c1-9(13(19)20)8-11(17)16-7-5-4-6-10(14-2)12(18)15-3/h8,10,14H,4-7H2,1-3H3,(H,15,18)(H,16,17)(H,19,20)/b9-8-.
What are the key properties of (Z)-4-[[5,6-bis(methylamino)-6-oxohexyl]amino]-2-methyl-4-oxobut-2-enoic acid?
(Z)-4-[[5,6-bis(methylamino)-6-oxohexyl]amino]-2-methyl-4-oxobut-2-enoic acid has a molecular weight of 285.34 g/mol, XLogP of -0.36, 9 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-[[5,6-bis(methylamino)-6-oxohexyl]amino]-2-methyl-4-oxobut-2-enoic acid is sourced from PubChem (CID 58836423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).