About (4S)-4-amino-5-(2,2-dimethylpyrrolidin-1-yl)-5-oxopentanoic acid
(4S)-4-amino-5-(2,2-dimethylpyrrolidin-1-yl)-5-oxopentanoic acid (PubChem CID 58836629) has the molecular formula C11H20N2O3
and a molecular weight of 228.29 g/mol. Its IUPAC name is (4S)-4-amino-5-(2,2-dimethylpyrrolidin-1-yl)-5-oxopentanoic acid.
Molecular Properties
| Compound Name | (4S)-4-amino-5-(2,2-dimethylpyrrolidin-1-yl)-5-oxopentanoic acid |
| PubChem CID | 58836629 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (4S)-4-amino-5-(2,2-dimethylpyrrolidin-1-yl)-5-oxopentanoic acid |
| SMILES | CC1(C)CCCN1C(=O)[C@@H](N)CCC(=O)O |
| InChI | InChI=1S/C11H20N2O3/c1-11(2)6-3-7-13(11)10(16)8(12)4-5-9(14)15/h8H,3-7,12H2,1-2H3,(H,14,15)/t8-/m0/s1 |
| InChIKey | KZJQFDLKRHJSBV-QMMMGPOBSA-N |
| XLogP | 0.58 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-4-amino-5-(2,2-dimethylpyrrolidin-1-yl)-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-amino-5-(2,2-dimethylpyrrolidin-1-yl)-5-oxopentanoic acid?
The IUPAC name of (4S)-4-amino-5-(2,2-dimethylpyrrolidin-1-yl)-5-oxopentanoic acid (CID 58836629) is (4S)-4-amino-5-(2,2-dimethylpyrrolidin-1-yl)-5-oxopentanoic acid.
What is the SMILES notation for (4S)-4-amino-5-(2,2-dimethylpyrrolidin-1-yl)-5-oxopentanoic acid?
The canonical SMILES for (4S)-4-amino-5-(2,2-dimethylpyrrolidin-1-yl)-5-oxopentanoic acid is CC1(C)CCCN1C(=O)[C@@H](N)CCC(=O)O.
What is the InChIKey of (4S)-4-amino-5-(2,2-dimethylpyrrolidin-1-yl)-5-oxopentanoic acid?
The InChIKey is KZJQFDLKRHJSBV-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H20N2O3/c1-11(2)6-3-7-13(11)10(16)8(12)4-5-9(14)15/h8H,3-7,12H2,1-2H3,(H,14,15)/t8-/m0/s1.
What are the key properties of (4S)-4-amino-5-(2,2-dimethylpyrrolidin-1-yl)-5-oxopentanoic acid?
(4S)-4-amino-5-(2,2-dimethylpyrrolidin-1-yl)-5-oxopentanoic acid has a molecular weight of 228.29 g/mol, XLogP of 0.58, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-amino-5-(2,2-dimethylpyrrolidin-1-yl)-5-oxopentanoic acid is sourced from PubChem (CID 58836629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).