About 2-methoxy-4,6-dimethyl-1,2-dihydropyridine-3-carbonitrile
2-methoxy-4,6-dimethyl-1,2-dihydropyridine-3-carbonitrile (PubChem CID 58836840) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-methoxy-4,6-dimethyl-1,2-dihydropyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-methoxy-4,6-dimethyl-1,2-dihydropyridine-3-carbonitrile |
| PubChem CID | 58836840 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2-methoxy-4,6-dimethyl-1,2-dihydropyridine-3-carbonitrile |
| SMILES | COC1NC(C)=CC(C)=C1C#N |
| InChI | InChI=1S/C9H12N2O/c1-6-4-7(2)11-9(12-3)8(6)5-10/h4,9,11H,1-3H3 |
| InChIKey | BCMSXYZAPZTFEG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-4,6-dimethyl-1,2-dihydropyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4,6-dimethyl-1,2-dihydropyridine-3-carbonitrile?
The IUPAC name of 2-methoxy-4,6-dimethyl-1,2-dihydropyridine-3-carbonitrile (CID 58836840) is 2-methoxy-4,6-dimethyl-1,2-dihydropyridine-3-carbonitrile.
What is the SMILES notation for 2-methoxy-4,6-dimethyl-1,2-dihydropyridine-3-carbonitrile?
The canonical SMILES for 2-methoxy-4,6-dimethyl-1,2-dihydropyridine-3-carbonitrile is COC1NC(C)=CC(C)=C1C#N.
What is the InChIKey of 2-methoxy-4,6-dimethyl-1,2-dihydropyridine-3-carbonitrile?
The InChIKey is BCMSXYZAPZTFEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-6-4-7(2)11-9(12-3)8(6)5-10/h4,9,11H,1-3H3.
What are the key properties of 2-methoxy-4,6-dimethyl-1,2-dihydropyridine-3-carbonitrile?
2-methoxy-4,6-dimethyl-1,2-dihydropyridine-3-carbonitrile has a molecular weight of 164.21 g/mol, XLogP of 1.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4,6-dimethyl-1,2-dihydropyridine-3-carbonitrile is sourced from PubChem (CID 58836840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).