C29H33N3O8 — CID 58837017
[5-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]-[2-(2-methoxyphenoxy)ethyl]amino]-5-oxopentyl] nitrate (PubChem CID 58837017) has the molecular formula C29H33N3O8 and a molecular weight of 551.60 g/mol. Its IUPAC name is [5-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]-[2-(2-methoxyphenoxy)ethyl]amino]-5-oxopentyl] nitrate.
| Compound Name | [5-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]-[2-(2-methoxyphenoxy)ethyl]amino]-5-oxopentyl] nitrate |
|---|---|
| PubChem CID | 58837017 |
| Molecular Formula | C29H33N3O8 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | [5-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]-[2-(2-methoxyphenoxy)ethyl]amino]-5-oxopentyl] nitrate |
| SMILES | COc1ccccc1OCCN(CC(O)COc1cccc2[nH]c3ccccc3c12)C(=O)CCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C29H33N3O8/c1-37-25-12-4-5-13-26(25)38-18-16-31(28(34)15-6-7-17-40-32(35)36)19-21(33)20-39-27-14-8-11-24-29(27)22-9-2-3-10-23(22)30-24/h2-5,8-14,21,30,33H,6-7,15-20H2,1H3 |
| InChIKey | KEFGBZNGZSGUOV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 136.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|