About 2-(3,6-dihydro-2H-pyridin-1-yl)ethyl acetate
2-(3,6-dihydro-2H-pyridin-1-yl)ethyl acetate (PubChem CID 58837120) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-pyridin-1-yl)ethyl acetate.
Molecular Properties
| Compound Name | 2-(3,6-dihydro-2H-pyridin-1-yl)ethyl acetate |
| PubChem CID | 58837120 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 2-(3,6-dihydro-2H-pyridin-1-yl)ethyl acetate |
| SMILES | CC(=O)OCCN1CC=CCC1 |
| InChI | InChI=1S/C9H15NO2/c1-9(11)12-8-7-10-5-3-2-4-6-10/h2-3H,4-8H2,1H3 |
| InChIKey | YMSDMKFKHWDPFQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,6-dihydro-2H-pyridin-1-yl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,6-dihydro-2H-pyridin-1-yl)ethyl acetate?
The IUPAC name of 2-(3,6-dihydro-2H-pyridin-1-yl)ethyl acetate (CID 58837120) is 2-(3,6-dihydro-2H-pyridin-1-yl)ethyl acetate.
What is the SMILES notation for 2-(3,6-dihydro-2H-pyridin-1-yl)ethyl acetate?
The canonical SMILES for 2-(3,6-dihydro-2H-pyridin-1-yl)ethyl acetate is CC(=O)OCCN1CC=CCC1.
What is the InChIKey of 2-(3,6-dihydro-2H-pyridin-1-yl)ethyl acetate?
The InChIKey is YMSDMKFKHWDPFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-9(11)12-8-7-10-5-3-2-4-6-10/h2-3H,4-8H2,1H3.
What are the key properties of 2-(3,6-dihydro-2H-pyridin-1-yl)ethyl acetate?
2-(3,6-dihydro-2H-pyridin-1-yl)ethyl acetate has a molecular weight of 169.22 g/mol, XLogP of 0.81, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,6-dihydro-2H-pyridin-1-yl)ethyl acetate is sourced from PubChem (CID 58837120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).