About (1,4-dimethylpiperazin-2-yl)methanol;bis(rubidium(1+))
(1,4-dimethylpiperazin-2-yl)methanol;bis(rubidium(1+)) (PubChem CID 58837155) has the molecular formula C7H15N2ORb2+
and a molecular weight of 314.15 g/mol. Its IUPAC name is (1,4-dimethylpiperazin-2-yl)methanol;bis(rubidium(1+)).
Molecular Properties
| Compound Name | (1,4-dimethylpiperazin-2-yl)methanol;bis(rubidium(1+)) |
| PubChem CID | 58837155 |
| Molecular Formula | C7H15N2ORb2+ |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 312.94 |
| IUPAC Name | (1,4-dimethylpiperazin-2-yl)methanol;bis(rubidium(1+)) |
| SMILES | CN1CCN(C)C([CH-]O)C1.[Rb+].[Rb+] |
| InChI | InChI=1S/C7H15N2O.2Rb/c1-8-3-4-9(2)7(5-8)6-10;;/h6-7,10H,3-5H2,1-2H3;;/q-1;2*+1 |
| InChIKey | VYKAQELDDILWJV-UHFFFAOYSA-N |
| XLogP | -6.23 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | -6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (1,4-dimethylpiperazin-2-yl)methanol;bis(rubidium(1+)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,4-dimethylpiperazin-2-yl)methanol;bis(rubidium(1+))?
The IUPAC name of (1,4-dimethylpiperazin-2-yl)methanol;bis(rubidium(1+)) (CID 58837155) is (1,4-dimethylpiperazin-2-yl)methanol;bis(rubidium(1+)).
What is the SMILES notation for (1,4-dimethylpiperazin-2-yl)methanol;bis(rubidium(1+))?
The canonical SMILES for (1,4-dimethylpiperazin-2-yl)methanol;bis(rubidium(1+)) is CN1CCN(C)C([CH-]O)C1.[Rb+].[Rb+].
What is the InChIKey of (1,4-dimethylpiperazin-2-yl)methanol;bis(rubidium(1+))?
The InChIKey is VYKAQELDDILWJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N2O.2Rb/c1-8-3-4-9(2)7(5-8)6-10;;/h6-7,10H,3-5H2,1-2H3;;/q-1;2*+1.
What are the key properties of (1,4-dimethylpiperazin-2-yl)methanol;bis(rubidium(1+))?
(1,4-dimethylpiperazin-2-yl)methanol;bis(rubidium(1+)) has a molecular weight of 314.15 g/mol, XLogP of -6.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,4-dimethylpiperazin-2-yl)methanol;bis(rubidium(1+)) is sourced from PubChem (CID 58837155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).