About 3-[5,6-dimethoxy-1-[4-(4-methoxyphenoxy)phenyl]sulfonylindol-3-yl]propanoic acid
3-[5,6-dimethoxy-1-[4-(4-methoxyphenoxy)phenyl]sulfonylindol-3-yl]propanoic acid (PubChem CID 58838099) has the molecular formula C26H25NO8S
and a molecular weight of 511.55 g/mol. Its IUPAC name is 3-[5,6-dimethoxy-1-[4-(4-methoxyphenoxy)phenyl]sulfonylindol-3-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[5,6-dimethoxy-1-[4-(4-methoxyphenoxy)phenyl]sulfonylindol-3-yl]propanoic acid |
| PubChem CID | 58838099 |
| Molecular Formula | C26H25NO8S |
| Molecular Weight | 511.55 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 3-[5,6-dimethoxy-1-[4-(4-methoxyphenoxy)phenyl]sulfonylindol-3-yl]propanoic acid |
| SMILES | COc1ccc(Oc2ccc(S(=O)(=O)n3cc(CCC(=O)O)c4cc(OC)c(OC)cc43)cc2)cc1 |
| InChI | InChI=1S/C26H25NO8S/c1-32-18-5-7-19(8-6-18)35-20-9-11-21(12-10-20)36(30,31)27-16-17(4-13-26(28)29)22-14-24(33-2)25(34-3)15-23(22)27/h5-12,14-16H,4,13H2,1-3H3,(H,28,29) |
| InChIKey | SIKWECBKLGOVGL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 511.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-[5,6-dimethoxy-1-[4-(4-methoxyphenoxy)phenyl]sulfonylindol-3-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5,6-dimethoxy-1-[4-(4-methoxyphenoxy)phenyl]sulfonylindol-3-yl]propanoic acid?
The IUPAC name of 3-[5,6-dimethoxy-1-[4-(4-methoxyphenoxy)phenyl]sulfonylindol-3-yl]propanoic acid (CID 58838099) is 3-[5,6-dimethoxy-1-[4-(4-methoxyphenoxy)phenyl]sulfonylindol-3-yl]propanoic acid.
What is the SMILES notation for 3-[5,6-dimethoxy-1-[4-(4-methoxyphenoxy)phenyl]sulfonylindol-3-yl]propanoic acid?
The canonical SMILES for 3-[5,6-dimethoxy-1-[4-(4-methoxyphenoxy)phenyl]sulfonylindol-3-yl]propanoic acid is COc1ccc(Oc2ccc(S(=O)(=O)n3cc(CCC(=O)O)c4cc(OC)c(OC)cc43)cc2)cc1.
What is the InChIKey of 3-[5,6-dimethoxy-1-[4-(4-methoxyphenoxy)phenyl]sulfonylindol-3-yl]propanoic acid?
The InChIKey is SIKWECBKLGOVGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25NO8S/c1-32-18-5-7-19(8-6-18)35-20-9-11-21(12-10-20)36(30,31)27-16-17(4-13-26(28)29)22-14-24(33-2)25(34-3)15-23(22)27/h5-12,14-16H,4,13H2,1-3H3,(H,28,29).
What are the key properties of 3-[5,6-dimethoxy-1-[4-(4-methoxyphenoxy)phenyl]sulfonylindol-3-yl]propanoic acid?
3-[5,6-dimethoxy-1-[4-(4-methoxyphenoxy)phenyl]sulfonylindol-3-yl]propanoic acid has a molecular weight of 511.55 g/mol, XLogP of 4.71, 10 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5,6-dimethoxy-1-[4-(4-methoxyphenoxy)phenyl]sulfonylindol-3-yl]propanoic acid is sourced from PubChem (CID 58838099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).