C11H19NO — CID 58838492
1-(2,2,3,5,5-pentamethylpyrrol-1-yl)ethanone (PubChem CID 58838492) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-(2,2,3,5,5-pentamethylpyrrol-1-yl)ethanone.
| Compound Name | 1-(2,2,3,5,5-pentamethylpyrrol-1-yl)ethanone |
|---|---|
| PubChem CID | 58838492 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-(2,2,3,5,5-pentamethylpyrrol-1-yl)ethanone |
| SMILES | CC(=O)N1C(C)(C)C=C(C)C1(C)C |
| InChI | InChI=1S/C11H19NO/c1-8-7-10(3,4)12(9(2)13)11(8,5)6/h7H,1-6H3 |
| InChIKey | RRMGJGLIUNLWMB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|