C17H21Br — CID 58838707
4-bromo-9-ethynyl-3-methylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (PubChem CID 58838707) has the molecular formula C17H21Br and a molecular weight of 305.26 g/mol. Its IUPAC name is 4-bromo-9-ethynyl-3-methylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
| Compound Name | 4-bromo-9-ethynyl-3-methylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
|---|---|
| PubChem CID | 58838707 |
| Molecular Formula | C17H21Br |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-bromo-9-ethynyl-3-methylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
| SMILES | C#CC12CC3C4CC5(Br)CC3C(C1)C(C4C2)C5C |
| InChI | InChI=1S/C17H21Br/c1-3-16-4-10-11-7-17(18)8-12(10)14(6-16)15(9(17)2)13(11)5-16/h1,9-15H,4-8H2,2H3 |
| InChIKey | RVAIYJSXMVGFNJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|