About 1,4-di(pyrazol-1-yl)naphthalene-2,3-dicarbonitrile
1,4-di(pyrazol-1-yl)naphthalene-2,3-dicarbonitrile (PubChem CID 58838850) has the molecular formula C18H10N6
and a molecular weight of 310.32 g/mol. Its IUPAC name is 1,4-di(pyrazol-1-yl)naphthalene-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 1,4-di(pyrazol-1-yl)naphthalene-2,3-dicarbonitrile |
| PubChem CID | 58838850 |
| Molecular Formula | C18H10N6 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1,4-di(pyrazol-1-yl)naphthalene-2,3-dicarbonitrile |
| SMILES | N#Cc1c(C#N)c(-n2cccn2)c2ccccc2c1-n1cccn1 |
| InChI | InChI=1S/C18H10N6/c19-11-15-16(12-20)18(24-10-4-8-22-24)14-6-2-1-5-13(14)17(15)23-9-3-7-21-23/h1-10H |
| InChIKey | QCLGEMJDOMDBTN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 83.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,4-di(pyrazol-1-yl)naphthalene-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-di(pyrazol-1-yl)naphthalene-2,3-dicarbonitrile?
The IUPAC name of 1,4-di(pyrazol-1-yl)naphthalene-2,3-dicarbonitrile (CID 58838850) is 1,4-di(pyrazol-1-yl)naphthalene-2,3-dicarbonitrile.
What is the SMILES notation for 1,4-di(pyrazol-1-yl)naphthalene-2,3-dicarbonitrile?
The canonical SMILES for 1,4-di(pyrazol-1-yl)naphthalene-2,3-dicarbonitrile is N#Cc1c(C#N)c(-n2cccn2)c2ccccc2c1-n1cccn1.
What is the InChIKey of 1,4-di(pyrazol-1-yl)naphthalene-2,3-dicarbonitrile?
The InChIKey is QCLGEMJDOMDBTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10N6/c19-11-15-16(12-20)18(24-10-4-8-22-24)14-6-2-1-5-13(14)17(15)23-9-3-7-21-23/h1-10H.
What are the key properties of 1,4-di(pyrazol-1-yl)naphthalene-2,3-dicarbonitrile?
1,4-di(pyrazol-1-yl)naphthalene-2,3-dicarbonitrile has a molecular weight of 310.32 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-di(pyrazol-1-yl)naphthalene-2,3-dicarbonitrile is sourced from PubChem (CID 58838850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).