About 4-bromo-5-diphenylphosphoryl-2,2-difluoro-7-methyl-1,3-benzodioxole
4-bromo-5-diphenylphosphoryl-2,2-difluoro-7-methyl-1,3-benzodioxole (PubChem CID 58839258) has the molecular formula C20H14BrF2O3P
and a molecular weight of 451.20 g/mol. Its IUPAC name is 4-bromo-5-diphenylphosphoryl-2,2-difluoro-7-methyl-1,3-benzodioxole.
Molecular Properties
| Compound Name | 4-bromo-5-diphenylphosphoryl-2,2-difluoro-7-methyl-1,3-benzodioxole |
| PubChem CID | 58839258 |
| Molecular Formula | C20H14BrF2O3P |
| Molecular Weight | 451.20 g/mol |
| Exact Mass | 449.98 |
| IUPAC Name | 4-bromo-5-diphenylphosphoryl-2,2-difluoro-7-methyl-1,3-benzodioxole |
| SMILES | Cc1cc(P(=O)(c2ccccc2)c2ccccc2)c(Br)c2c1OC(F)(F)O2 |
| InChI | InChI=1S/C20H14BrF2O3P/c1-13-12-16(17(21)19-18(13)25-20(22,23)26-19)27(24,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-12H,1H3 |
| InChIKey | IURKGPARWVJAFF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.20 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-5-diphenylphosphoryl-2,2-difluoro-7-methyl-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-diphenylphosphoryl-2,2-difluoro-7-methyl-1,3-benzodioxole?
The IUPAC name of 4-bromo-5-diphenylphosphoryl-2,2-difluoro-7-methyl-1,3-benzodioxole (CID 58839258) is 4-bromo-5-diphenylphosphoryl-2,2-difluoro-7-methyl-1,3-benzodioxole.
What is the SMILES notation for 4-bromo-5-diphenylphosphoryl-2,2-difluoro-7-methyl-1,3-benzodioxole?
The canonical SMILES for 4-bromo-5-diphenylphosphoryl-2,2-difluoro-7-methyl-1,3-benzodioxole is Cc1cc(P(=O)(c2ccccc2)c2ccccc2)c(Br)c2c1OC(F)(F)O2.
What is the InChIKey of 4-bromo-5-diphenylphosphoryl-2,2-difluoro-7-methyl-1,3-benzodioxole?
The InChIKey is IURKGPARWVJAFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14BrF2O3P/c1-13-12-16(17(21)19-18(13)25-20(22,23)26-19)27(24,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-12H,1H3.
What are the key properties of 4-bromo-5-diphenylphosphoryl-2,2-difluoro-7-methyl-1,3-benzodioxole?
4-bromo-5-diphenylphosphoryl-2,2-difluoro-7-methyl-1,3-benzodioxole has a molecular weight of 451.20 g/mol, XLogP of 4.72, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-diphenylphosphoryl-2,2-difluoro-7-methyl-1,3-benzodioxole is sourced from PubChem (CID 58839258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).