C29H36F4O — CID 58839578
5-fluoro-2-[4-(4-propoxybutyl)cyclohexyl]-6-(3,4,5-trifluorophenyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 58839578) has the molecular formula C29H36F4O and a molecular weight of 476.60 g/mol. Its IUPAC name is 5-fluoro-2-[4-(4-propoxybutyl)cyclohexyl]-6-(3,4,5-trifluorophenyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-fluoro-2-[4-(4-propoxybutyl)cyclohexyl]-6-(3,4,5-trifluorophenyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 58839578 |
| Molecular Formula | C29H36F4O |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 5-fluoro-2-[4-(4-propoxybutyl)cyclohexyl]-6-(3,4,5-trifluorophenyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCOCCCCC1CCC(C2CCc3c(ccc(-c4cc(F)c(F)c(F)c4)c3F)C2)CC1 |
| InChI | InChI=1S/C29H36F4O/c1-2-14-34-15-4-3-5-19-6-8-20(9-7-19)21-10-12-24-22(16-21)11-13-25(28(24)32)23-17-26(30)29(33)27(31)18-23/h11,13,17-21H,2-10,12,14-16H2,1H3 |
| InChIKey | ZXIJREYWNQQVPT-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|