C11H20O — CID 58839769
3,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-chromene (PubChem CID 58839769) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 3,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-chromene.
| Compound Name | 3,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-chromene |
|---|---|
| PubChem CID | 58839769 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 3,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-chromene |
| SMILES | CC1COC2CC(C)CCC2C1 |
| InChI | InChI=1S/C11H20O/c1-8-3-4-10-5-9(2)7-12-11(10)6-8/h8-11H,3-7H2,1-2H3 |
| InChIKey | GTRBCKSKSHIIKD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |