C15H24F6O2 — CID 58840386
1-butan-2-yl-4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]cyclohexane (PubChem CID 58840386) has the molecular formula C15H24F6O2 and a molecular weight of 350.34 g/mol. Its IUPAC name is 1-butan-2-yl-4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]cyclohexane.
| Compound Name | 1-butan-2-yl-4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]cyclohexane |
|---|---|
| PubChem CID | 58840386 |
| Molecular Formula | C15H24F6O2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-butan-2-yl-4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]cyclohexane |
| SMILES | CCC(C)C1CCC(C(OCOC)(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H24F6O2/c1-4-10(2)11-5-7-12(8-6-11)13(14(16,17)18,15(19,20)21)23-9-22-3/h10-12H,4-9H2,1-3H3 |
| InChIKey | AJGWLXGXBNGYFK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|